C12H19N5O4 — CID 112531885
methyl N-[2-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112531885) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl N-[2-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112531885 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl N-[2-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)N2CCCCC2CO)n1 |
| InChI | InChI=1S/C12H19N5O4/c1-21-12(20)14-10-6-13-17(15-10)7-11(19)16-5-3-2-4-9(16)8-18/h6,9,18H,2-5,7-8H2,1H3,(H,14,15,20) |
| InChIKey | GISYIQIFLVNMBG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |