C12H19N5O5S — CID 112531575
methyl 1-[2-[4-(methanesulfonamido)triazol-2-yl]acetyl]piperidine-2-carboxylate (PubChem CID 112531575) has the molecular formula C12H19N5O5S and a molecular weight of 345.38 g/mol. Its IUPAC name is methyl 1-[2-[4-(methanesulfonamido)triazol-2-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-[4-(methanesulfonamido)triazol-2-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 112531575 |
| Molecular Formula | C12H19N5O5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | methyl 1-[2-[4-(methanesulfonamido)triazol-2-yl]acetyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)Cn1ncc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H19N5O5S/c1-22-12(19)9-5-3-4-6-16(9)11(18)8-17-13-7-10(14-17)15-23(2,20)21/h7,9H,3-6,8H2,1-2H3,(H,14,15) |
| InChIKey | BDKMDOGPIMWRGX-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |