C9H15N5O4 — CID 112531448
methyl N-[2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112531448) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl N-[2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | methyl N-[2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112531448 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl N-[2-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | COC(=O)Nc1cnn(CC(=O)N(C)CCO)n1 |
| InChI | InChI=1S/C9H15N5O4/c1-13(3-4-15)8(16)6-14-10-5-7(12-14)11-9(17)18-2/h5,15H,3-4,6H2,1-2H3,(H,11,12,17) |
| InChIKey | AVYLPJARBXYJSO-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |