C13H16ClN5O2 — CID 116642136
2-[4-(2-aminoethyl)triazol-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 116642136) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)triazol-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 116642136 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[4-(2-aminoethyl)triazol-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cc(CCN)nn2)cc1Cl |
| InChI | InChI=1S/C13H16ClN5O2/c1-21-12-3-2-9(6-11(12)14)16-13(20)8-19-7-10(4-5-15)17-18-19/h2-3,6-7H,4-5,8,15H2,1H3,(H,16,20) |
| InChIKey | UOFBTVWLANKUHU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |