C15H18ClN5O3 — CID 112521514
N-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide (PubChem CID 112521514) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 112521514 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
| SMILES | COc1ccc(NC(=O)Cn2cc(NC(=O)C(C)C)nn2)cc1Cl |
| InChI | InChI=1S/C15H18ClN5O3/c1-9(2)15(23)18-13-7-21(20-19-13)8-14(22)17-10-4-5-12(24-3)11(16)6-10/h4-7,9H,8H2,1-3H3,(H,17,22)(H,18,23) |
| InChIKey | XJKQGERRPMOKNY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |