C12H21N5O2 — CID 112520071
2-methyl-N-[1-[2-(2-methylpropylamino)-2-oxoethyl]triazol-4-yl]propanamide (PubChem CID 112520071) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-(2-methylpropylamino)-2-oxoethyl]triazol-4-yl]propanamide.
| Compound Name | 2-methyl-N-[1-[2-(2-methylpropylamino)-2-oxoethyl]triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 112520071 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-methyl-N-[1-[2-(2-methylpropylamino)-2-oxoethyl]triazol-4-yl]propanamide |
| SMILES | CC(C)CNC(=O)Cn1cc(NC(=O)C(C)C)nn1 |
| InChI | InChI=1S/C12H21N5O2/c1-8(2)5-13-11(18)7-17-6-10(15-16-17)14-12(19)9(3)4/h6,8-9H,5,7H2,1-4H3,(H,13,18)(H,14,19) |
| InChIKey | UCTYAXINGWXKGF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |