C14H16FN5O2 — CID 112521311
N-[1-[2-(2-fluoroanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide (PubChem CID 112521311) has the molecular formula C14H16FN5O2 and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[1-[2-(2-fluoroanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-[2-(2-fluoroanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 112521311 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[1-[2-(2-fluoroanilino)-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cn(CC(=O)Nc2ccccc2F)nn1 |
| InChI | InChI=1S/C14H16FN5O2/c1-9(2)14(22)17-12-7-20(19-18-12)8-13(21)16-11-6-4-3-5-10(11)15/h3-7,9H,8H2,1-2H3,(H,16,21)(H,17,22) |
| InChIKey | STINYGHGZPGNPM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |