C12H11FN4O4 — CID 66289937
1-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289937) has the molecular formula C12H11FN4O4 and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289937 |
| Molecular Formula | C12H11FN4O4 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(NC(=O)Cn2cc(C(=O)O)nn2)cc1F |
| InChI | InChI=1S/C12H11FN4O4/c1-21-10-3-2-7(4-8(10)13)14-11(18)6-17-5-9(12(19)20)15-16-17/h2-5H,6H2,1H3,(H,14,18)(H,19,20) |
| InChIKey | KIOYGKGPHZCVSA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |