C10H9N5O3 — CID 66288893
1-[2-oxo-2-(pyridin-4-ylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 66288893) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 1-[2-oxo-2-(pyridin-4-ylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(pyridin-4-ylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66288893 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-[2-oxo-2-(pyridin-4-ylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)nn1)Nc1ccncc1 |
| InChI | InChI=1S/C10H9N5O3/c16-9(12-7-1-3-11-4-2-7)6-15-5-8(10(17)18)13-14-15/h1-5H,6H2,(H,17,18)(H,11,12,16) |
| InChIKey | HQHKUKMRBFFAKB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |