C11H10N4O3 — CID 19482824
2-[2-oxo-2-(pyridin-4-ylamino)ethyl]pyrazole-3-carboxylic acid (PubChem CID 19482824) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-[2-oxo-2-(pyridin-4-ylamino)ethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-oxo-2-(pyridin-4-ylamino)ethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19482824 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-[2-oxo-2-(pyridin-4-ylamino)ethyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(Cn1nccc1C(=O)O)Nc1ccncc1 |
| InChI | InChI=1S/C11H10N4O3/c16-10(14-8-1-4-12-5-2-8)7-15-9(11(17)18)3-6-13-15/h1-6H,7H2,(H,17,18)(H,12,14,16) |
| InChIKey | OHERMDVZFNRGQZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |