C6H6N2O4 — CID 19485803
2-(carboxymethyl)pyrazole-3-carboxylic acid (PubChem CID 19485803) has the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. Its IUPAC name is 2-(carboxymethyl)pyrazole-3-carboxylic acid.
| Compound Name | 2-(carboxymethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485803 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-(carboxymethyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)Cn1nccc1C(=O)O |
| InChI | InChI=1S/C6H6N2O4/c9-5(10)3-8-4(6(11)12)1-2-7-8/h1-2H,3H2,(H,9,10)(H,11,12) |
| InChIKey | JFPMBFIUFLIHDL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |