C11H16N4O3 — CID 60780092
2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 60780092) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 60780092 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | CN1CCN(C(=O)Cn2nccc2C(=O)O)CC1 |
| InChI | InChI=1S/C11H16N4O3/c1-13-4-6-14(7-5-13)10(16)8-15-9(11(17)18)2-3-12-15/h2-3H,4-8H2,1H3,(H,17,18) |
| InChIKey | CGOKCVLWYWNCTE-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |