C17H19ClN4O3 — CID 19485579
2-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19485579) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 2-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485579 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccnn1CC(=O)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19ClN4O3/c18-14-3-1-2-13(10-14)11-20-6-8-21(9-7-20)16(23)12-22-15(17(24)25)4-5-19-22/h1-5,10H,6-9,11-12H2,(H,24,25) |
| InChIKey | HWXKMPYCKHFEIK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |