C21H21ClN4O2 — CID 9092832
1-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]cinnolin-4-one (PubChem CID 9092832) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 1-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]cinnolin-4-one.
| Compound Name | 1-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]cinnolin-4-one |
|---|---|
| PubChem CID | 9092832 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]cinnolin-4-one |
| SMILES | O=C(Cn1ncc(=O)c2ccccc21)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c22-17-5-3-4-16(12-17)14-24-8-10-25(11-9-24)21(28)15-26-19-7-2-1-6-18(19)20(27)13-23-26/h1-7,12-13H,8-11,14-15H2 |
| InChIKey | PDRZTSNDQQVCMU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |