C19H20ClN5O — CID 19323586
2-(benzotriazol-1-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 19323586) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(benzotriazol-1-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19323586 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(Cn1nnc2ccccc21)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H20ClN5O/c20-16-5-3-4-15(12-16)13-23-8-10-24(11-9-23)19(26)14-25-18-7-2-1-6-17(18)21-22-25/h1-7,12H,8-11,13-14H2 |
| InChIKey | WKCSYTOOCYYQKI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |