C21H23ClN6O — CID 55411399
1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[5-(4-methylphenyl)tetrazol-2-yl]ethanone (PubChem CID 55411399) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[5-(4-methylphenyl)tetrazol-2-yl]ethanone.
| Compound Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[5-(4-methylphenyl)tetrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 55411399 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[5-(4-methylphenyl)tetrazol-2-yl]ethanone |
| SMILES | Cc1ccc(-c2nnn(CC(=O)N3CCN(Cc4cccc(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H23ClN6O/c1-16-5-7-18(8-6-16)21-23-25-28(24-21)15-20(29)27-11-9-26(10-12-27)14-17-3-2-4-19(22)13-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | UFEXSJDHFAUTQK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |