C12H18N4O5S — CID 19485709
2-[2-(4-ethylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19485709) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[2-(4-ethylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-(4-ethylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485709 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-(4-ethylsulfonylpiperazin-1-yl)-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | CCS(=O)(=O)N1CCN(C(=O)Cn2nccc2C(=O)O)CC1 |
| InChI | InChI=1S/C12H18N4O5S/c1-2-22(20,21)15-7-5-14(6-8-15)11(17)9-16-10(12(18)19)3-4-13-16/h3-4H,2,5-9H2,1H3,(H,18,19) |
| InChIKey | LHOMFVASDKTTGB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |