C10H11N5O3 — CID 19485630
2-[2-[(1-methylpyrazol-3-yl)amino]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19485630) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-[2-[(1-methylpyrazol-3-yl)amino]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-[(1-methylpyrazol-3-yl)amino]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485630 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[2-[(1-methylpyrazol-3-yl)amino]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | Cn1ccc(NC(=O)Cn2nccc2C(=O)O)n1 |
| InChI | InChI=1S/C10H11N5O3/c1-14-5-3-8(13-14)12-9(16)6-15-7(10(17)18)2-4-11-15/h2-5H,6H2,1H3,(H,17,18)(H,12,13,16) |
| InChIKey | HQXFNAJLSIWWBO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |