C8H8N6O3 — CID 66290982
1-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 66290982) has the molecular formula C8H8N6O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66290982 |
| Molecular Formula | C8H8N6O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-[2-oxo-2-(1H-pyrazol-4-ylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)nn1)Nc1cn[nH]c1 |
| InChI | InChI=1S/C8H8N6O3/c15-7(11-5-1-9-10-2-5)4-14-3-6(8(16)17)12-13-14/h1-3H,4H2,(H,9,10)(H,11,15)(H,16,17) |
| InChIKey | ZBVPQDWFUOPWBF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |