C11H11N5O3 — CID 66289742
1-[2-(2-aminoanilino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289742) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 1-[2-(2-aminoanilino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-aminoanilino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289742 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-[2-(2-aminoanilino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | Nc1ccccc1NC(=O)Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H11N5O3/c12-7-3-1-2-4-8(7)13-10(17)6-16-5-9(11(18)19)14-15-16/h1-5H,6,12H2,(H,13,17)(H,18,19) |
| InChIKey | JGBFOWMYNDRBDJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|