C13H14N4O4 — CID 66289113
1-[2-[4-(2-hydroxyethyl)anilino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66289113) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-[4-(2-hydroxyethyl)anilino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[4-(2-hydroxyethyl)anilino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66289113 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-[4-(2-hydroxyethyl)anilino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | O=C(Cn1cc(C(=O)O)nn1)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C13H14N4O4/c18-6-5-9-1-3-10(4-2-9)14-12(19)8-17-7-11(13(20)21)15-16-17/h1-4,7,18H,5-6,8H2,(H,14,19)(H,20,21) |
| InChIKey | AOWCPNQZYMXUOU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |