C10H12N6O3 — CID 66287862
1-[2-[(1-ethylpyrazol-4-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 66287862) has the molecular formula C10H12N6O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is 1-[2-[(1-ethylpyrazol-4-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(1-ethylpyrazol-4-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66287862 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-[2-[(1-ethylpyrazol-4-yl)amino]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CCn1cc(NC(=O)Cn2cc(C(=O)O)nn2)cn1 |
| InChI | InChI=1S/C10H12N6O3/c1-2-15-4-7(3-11-15)12-9(17)6-16-5-8(10(18)19)13-14-16/h3-5H,2,6H2,1H3,(H,12,17)(H,18,19) |
| InChIKey | WGVMXSNDGUBWGY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |