About 1H-pyrazol-4-ylcarbamic acid
1H-pyrazol-4-ylcarbamic acid (PubChem CID 66846919) has the molecular formula C8H10N6O4
and a molecular weight of 254.21 g/mol. Its IUPAC name is 1H-pyrazol-4-ylcarbamic acid.
Molecular Properties
| Compound Name | 1H-pyrazol-4-ylcarbamic acid |
| PubChem CID | 66846919 |
| Molecular Formula | C8H10N6O4 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1H-pyrazol-4-ylcarbamic acid |
| SMILES | O=C(O)Nc1cn[nH]c1.O=C(O)Nc1cn[nH]c1 |
| InChI | InChI=1S/2C4H5N3O2/c2*8-4(9)7-3-1-5-6-2-3/h2*1-2,7H,(H,5,6)(H,8,9) |
| InChIKey | FFFGWASSLLVDSG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-pyrazol-4-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-4-ylcarbamic acid?
The IUPAC name of 1H-pyrazol-4-ylcarbamic acid (CID 66846919) is 1H-pyrazol-4-ylcarbamic acid.
What is the SMILES notation for 1H-pyrazol-4-ylcarbamic acid?
The canonical SMILES for 1H-pyrazol-4-ylcarbamic acid is O=C(O)Nc1cn[nH]c1.O=C(O)Nc1cn[nH]c1.
What is the InChIKey of 1H-pyrazol-4-ylcarbamic acid?
The InChIKey is FFFGWASSLLVDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5N3O2/c2*8-4(9)7-3-1-5-6-2-3/h2*1-2,7H,(H,5,6)(H,8,9).
What are the key properties of 1H-pyrazol-4-ylcarbamic acid?
1H-pyrazol-4-ylcarbamic acid has a molecular weight of 254.21 g/mol, XLogP of 1.00, 2 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-4-ylcarbamic acid is sourced from PubChem (CID 66846919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).