About 1H-pyrazol-4-ylcarbamic acid
1H-pyrazol-4-ylcarbamic acid (PubChem CID 66846920) has the molecular formula C4H5N3O2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 1H-pyrazol-4-ylcarbamic acid.
Molecular Properties
| Compound Name | 1H-pyrazol-4-ylcarbamic acid |
| PubChem CID | 66846920 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 1H-pyrazol-4-ylcarbamic acid |
| SMILES | O=C(O)Nc1cn[nH]c1 |
| InChI | InChI=1S/C4H5N3O2/c8-4(9)7-3-1-5-6-2-3/h1-2,7H,(H,5,6)(H,8,9) |
| InChIKey | ZIQAVMIKEIMTPT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrazol-4-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-4-ylcarbamic acid?
The IUPAC name of 1H-pyrazol-4-ylcarbamic acid (CID 66846920) is 1H-pyrazol-4-ylcarbamic acid.
What is the SMILES notation for 1H-pyrazol-4-ylcarbamic acid?
The canonical SMILES for 1H-pyrazol-4-ylcarbamic acid is O=C(O)Nc1cn[nH]c1.
What is the InChIKey of 1H-pyrazol-4-ylcarbamic acid?
The InChIKey is ZIQAVMIKEIMTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c8-4(9)7-3-1-5-6-2-3/h1-2,7H,(H,5,6)(H,8,9).
What are the key properties of 1H-pyrazol-4-ylcarbamic acid?
1H-pyrazol-4-ylcarbamic acid has a molecular weight of 127.10 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-4-ylcarbamic acid is sourced from PubChem (CID 66846920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).