C13H13FN4O3 — CID 122241395
methyl 1-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 122241395) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is methyl 1-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241395 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | methyl 1-[2-(2-fluoro-4-methylanilino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)Nc2ccc(C)cc2F)nn1 |
| InChI | InChI=1S/C13H13FN4O3/c1-8-3-4-10(9(14)5-8)15-12(19)7-18-6-11(16-17-18)13(20)21-2/h3-6H,7H2,1-2H3,(H,15,19) |
| InChIKey | CVUCELAQZZSLOO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |