C11H12N4O4 — CID 103627033
methyl 1-[2-(furan-2-ylmethylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103627033) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is methyl 1-[2-(furan-2-ylmethylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-(furan-2-ylmethylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103627033 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl 1-[2-(furan-2-ylmethylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)NCc2ccco2)nn1 |
| InChI | InChI=1S/C11H12N4O4/c1-18-11(17)9-6-15(14-13-9)7-10(16)12-5-8-3-2-4-19-8/h2-4,6H,5,7H2,1H3,(H,12,16) |
| InChIKey | BYFAWZFPCBISDU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |