C15H14N4O5 — CID 7705969
methyl 3-[2-(furan-2-ylmethylamino)-2-oxoethoxy]benzotriazole-5-carboxylate (PubChem CID 7705969) has the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is methyl 3-[2-(furan-2-ylmethylamino)-2-oxoethoxy]benzotriazole-5-carboxylate.
| Compound Name | methyl 3-[2-(furan-2-ylmethylamino)-2-oxoethoxy]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7705969 |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 3-[2-(furan-2-ylmethylamino)-2-oxoethoxy]benzotriazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nnn(OCC(=O)NCc3ccco3)c2c1 |
| InChI | InChI=1S/C15H14N4O5/c1-22-15(21)10-4-5-12-13(7-10)19(18-17-12)24-9-14(20)16-8-11-3-2-6-23-11/h2-7H,8-9H2,1H3,(H,16,20) |
| InChIKey | BVHPFUSDNKQIQL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |