C16H13FN4O4 — CID 7706094
methyl 3-[2-(2-fluoroanilino)-2-oxoethoxy]benzotriazole-5-carboxylate (PubChem CID 7706094) has the molecular formula C16H13FN4O4 and a molecular weight of 344.30 g/mol. Its IUPAC name is methyl 3-[2-(2-fluoroanilino)-2-oxoethoxy]benzotriazole-5-carboxylate.
| Compound Name | methyl 3-[2-(2-fluoroanilino)-2-oxoethoxy]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7706094 |
| Molecular Formula | C16H13FN4O4 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 3-[2-(2-fluoroanilino)-2-oxoethoxy]benzotriazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nnn(OCC(=O)Nc3ccccc3F)c2c1 |
| InChI | InChI=1S/C16H13FN4O4/c1-24-16(23)10-6-7-13-14(8-10)21(20-19-13)25-9-15(22)18-12-5-3-2-4-11(12)17/h2-8H,9H2,1H3,(H,18,22) |
| InChIKey | ZXEVDRIOEZCLRR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |