C14H18N4O4 — CID 7706166
methyl 3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate (PubChem CID 7706166) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is methyl 3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate.
| Compound Name | methyl 3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7706166 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl 3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate |
| SMILES | CC[C@@H](C)NC(=O)COn1nnc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C14H18N4O4/c1-4-9(2)15-13(19)8-22-18-12-7-10(14(20)21-3)5-6-11(12)16-17-18/h5-7,9H,4,8H2,1-3H3,(H,15,19)/t9-/m1/s1 |
| InChIKey | BVPFFNUURDVJMX-SECBINFHSA-N |
| XLogP | 0.56 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |