C22H20N4O4 — CID 7706238
methyl 3-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate (PubChem CID 7706238) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is methyl 3-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate.
| Compound Name | methyl 3-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7706238 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 3-[2-[[(1S)-1-naphthalen-2-ylethyl]amino]-2-oxoethoxy]benzotriazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nnn(OCC(=O)N[C@@H](C)c3ccc4ccccc4c3)c2c1 |
| InChI | InChI=1S/C22H20N4O4/c1-14(16-8-7-15-5-3-4-6-17(15)11-16)23-21(27)13-30-26-20-12-18(22(28)29-2)9-10-19(20)24-25-26/h3-12,14H,13H2,1-2H3,(H,23,27)/t14-/m0/s1 |
| InChIKey | TVLLHWMKAMPABZ-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |