C17H18N4O4S — CID 7701532
2-(6-methylsulfonylbenzotriazol-1-yl)oxy-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 7701532) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-(6-methylsulfonylbenzotriazol-1-yl)oxy-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-(6-methylsulfonylbenzotriazol-1-yl)oxy-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7701532 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(6-methylsulfonylbenzotriazol-1-yl)oxy-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)COn1nnc2ccc(S(C)(=O)=O)cc21)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-12(13-6-4-3-5-7-13)18-17(22)11-25-21-16-10-14(26(2,23)24)8-9-15(16)19-20-21/h3-10,12H,11H2,1-2H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | BQDPCEWGSOFHOA-LBPRGKRZSA-N |
| XLogP | 1.14 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |