C20H24N3O4+ — CID 8829851
ethyl 1-ethyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-methylbenzimidazol-1-ium-5-carboxylate (PubChem CID 8829851) has the molecular formula C20H24N3O4+ and a molecular weight of 370.43 g/mol. Its IUPAC name is ethyl 1-ethyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-methylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 1-ethyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-methylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 8829851 |
| Molecular Formula | C20H24N3O4+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl 1-ethyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-methylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CC(=O)NCc1ccco1)c(C)[n+]2CC |
| InChI | InChI=1S/C20H23N3O4/c1-4-22-14(3)23(13-19(24)21-12-16-7-6-10-27-16)18-11-15(8-9-17(18)22)20(25)26-5-2/h6-11H,4-5,12-13H2,1-3H3/p+1 |
| InChIKey | HHPNXLNVKJCGSH-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|