C24H32N3O3+ — CID 8829747
ethyl 3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate (PubChem CID 8829747) has the molecular formula C24H32N3O3+ and a molecular weight of 410.54 g/mol. Its IUPAC name is ethyl 3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate.
| Compound Name | ethyl 3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 8829747 |
| Molecular Formula | C24H32N3O3+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | ethyl 3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-1-ethyl-2-methylbenzimidazol-1-ium-5-carboxylate |
| SMILES | CCCn1c(C)cc(C(=O)Cn2c(C)[n+](CC)c3ccc(C(=O)OCC)cc32)c1C |
| InChI | InChI=1S/C24H32N3O3/c1-7-12-26-16(4)13-20(17(26)5)23(28)15-27-18(6)25(8-2)21-11-10-19(14-22(21)27)24(29)30-9-3/h10-11,13-14H,7-9,12,15H2,1-6H3/q+1 |
| InChIKey | AELSSIMZDOQHRM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|