C14H20N3O+ — CID 170860268
2-amino-1-(1,3-diethyl-2-methylbenzimidazol-1-ium-5-yl)ethanone (PubChem CID 170860268) has the molecular formula C14H20N3O+ and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-amino-1-(1,3-diethyl-2-methylbenzimidazol-1-ium-5-yl)ethanone.
| Compound Name | 2-amino-1-(1,3-diethyl-2-methylbenzimidazol-1-ium-5-yl)ethanone |
|---|---|
| PubChem CID | 170860268 |
| Molecular Formula | C14H20N3O+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-amino-1-(1,3-diethyl-2-methylbenzimidazol-1-ium-5-yl)ethanone |
| SMILES | CCn1c(C)[n+](CC)c2ccc(C(=O)CN)cc21 |
| InChI | InChI=1S/C14H20N3O/c1-4-16-10(3)17(5-2)13-8-11(14(18)9-15)6-7-12(13)16/h6-8H,4-5,9,15H2,1-3H3/q+1 |
| InChIKey | PMZZRHRCWDRKLM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|