C16H25N4O+ — CID 158240162
N-(3-aminopropyl)-1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxamide (PubChem CID 158240162) has the molecular formula C16H25N4O+ and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(3-aminopropyl)-1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 158240162 |
| Molecular Formula | C16H25N4O+ |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-(3-aminopropyl)-1,3-diethyl-2-methylbenzimidazol-1-ium-5-carboxamide |
| SMILES | CCn1c(C)[n+](CC)c2ccc(C(=O)NCCCN)cc21 |
| InChI | InChI=1S/C16H24N4O/c1-4-19-12(3)20(5-2)15-11-13(7-8-14(15)19)16(21)18-10-6-9-17/h7-8,11H,4-6,9-10,17H2,1-3H3/p+1 |
| InChIKey | GFLGLOOMUPNDIJ-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|