C20H33N4O2+ — CID 134560803
tert-butyl N-[3-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]propyl]carbamate (PubChem CID 134560803) has the molecular formula C20H33N4O2+ and a molecular weight of 361.51 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]propyl]carbamate |
|---|---|
| PubChem CID | 134560803 |
| Molecular Formula | C20H33N4O2+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | tert-butyl N-[3-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]propyl]carbamate |
| SMILES | CCn1c(CN)[n+](CC)c2ccc(CCCNC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C20H32N4O2/c1-6-23-16-11-10-15(13-17(16)24(7-2)18(23)14-21)9-8-12-22-19(25)26-20(3,4)5/h10-11,13H,6-9,12,14,21H2,1-5H3/p+1 |
| InChIKey | ZDKDAVMUOVJOQY-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|