C29H31N4O4+ — CID 123367519
[1,3-diethyl-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzimidazol-1-ium-2-yl]methylcarbamic acid (PubChem CID 123367519) has the molecular formula C29H31N4O4+ and a molecular weight of 499.59 g/mol. Its IUPAC name is [1,3-diethyl-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzimidazol-1-ium-2-yl]methylcarbamic acid.
| Compound Name | [1,3-diethyl-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzimidazol-1-ium-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 123367519 |
| Molecular Formula | C29H31N4O4+ |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [1,3-diethyl-5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzimidazol-1-ium-2-yl]methylcarbamic acid |
| SMILES | CCn1c(CNC(=O)O)[n+](CC)c2ccc(CNC(=O)OCC3c4ccccc4-c4ccccc43)cc21 |
| InChI | InChI=1S/C29H30N4O4/c1-3-32-25-14-13-19(15-26(25)33(4-2)27(32)17-30-28(34)35)16-31-29(36)37-18-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-15,24,30H,3-4,16-18H2,1-2H3,(H-,31,34,35,36)/p+1 |
| InChIKey | DOBDKJAYAUOLLQ-UHFFFAOYSA-O |
| XLogP | 4.77 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|