C31H25NO5 — CID 102121065
methyl 4-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]benzoate (PubChem CID 102121065) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is methyl 4-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]benzoate.
| Compound Name | methyl 4-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]benzoate |
|---|---|
| PubChem CID | 102121065 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | methyl 4-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)c2ccc(CNC(=O)OCC3c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C31H25NO5/c1-36-30(34)23-16-14-22(15-17-23)29(33)21-12-10-20(11-13-21)18-32-31(35)37-19-28-26-8-4-2-6-24(26)25-7-3-5-9-27(25)28/h2-17,28H,18-19H2,1H3,(H,32,35) |
| InChIKey | NBQIVFSTWCMURE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |