C24H21NO4 — CID 172639206
5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylbenzoic acid (PubChem CID 172639206) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylbenzoic acid.
| Compound Name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 172639206 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C24H21NO4/c1-15-10-11-16(12-21(15)23(26)27)13-25-24(28)29-14-22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-12,22H,13-14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZQJTUBGMVMWYNJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |