C29H23NO3 — CID 87430743
9H-fluoren-9-ylmethyl N-[[3-(4-formylphenyl)phenyl]methyl]carbamate (PubChem CID 87430743) has the molecular formula C29H23NO3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[3-(4-formylphenyl)phenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[3-(4-formylphenyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 87430743 |
| Molecular Formula | C29H23NO3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[3-(4-formylphenyl)phenyl]methyl]carbamate |
| SMILES | O=Cc1ccc(-c2cccc(CNC(=O)OCC3c4ccccc4-c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C29H23NO3/c31-18-20-12-14-22(15-13-20)23-7-5-6-21(16-23)17-30-29(32)33-19-28-26-10-3-1-8-24(26)25-9-2-4-11-27(25)28/h1-16,18,28H,17,19H2,(H,30,32) |
| InChIKey | DNLXCZHLXQEHIP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|