C30H27NO4 — CID 135353911
9H-fluoren-9-ylmethyl N-[[2-[3-(hydroxymethyl)phenyl]-5-methoxyphenyl]methyl]carbamate (PubChem CID 135353911) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[2-[3-(hydroxymethyl)phenyl]-5-methoxyphenyl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[2-[3-(hydroxymethyl)phenyl]-5-methoxyphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135353911 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[2-[3-(hydroxymethyl)phenyl]-5-methoxyphenyl]methyl]carbamate |
| SMILES | COc1ccc(-c2cccc(CO)c2)c(CNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C30H27NO4/c1-34-23-13-14-24(21-8-6-7-20(15-21)18-32)22(16-23)17-31-30(33)35-19-29-27-11-4-2-9-25(27)26-10-3-5-12-28(26)29/h2-16,29,32H,17-19H2,1H3,(H,31,33) |
| InChIKey | FLWPGUUBIHQNQB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |