C18H20NO5P — CID 15339929
9H-fluoren-9-ylmethyl N-(dimethoxyphosphorylmethyl)carbamate (PubChem CID 15339929) has the molecular formula C18H20NO5P and a molecular weight of 361.33 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(dimethoxyphosphorylmethyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(dimethoxyphosphorylmethyl)carbamate |
|---|---|
| PubChem CID | 15339929 |
| Molecular Formula | C18H20NO5P |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(dimethoxyphosphorylmethyl)carbamate |
| SMILES | COP(=O)(CNC(=O)OCC1c2ccccc2-c2ccccc21)OC |
| InChI | InChI=1S/C18H20NO5P/c1-22-25(21,23-2)12-19-18(20)24-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,17H,11-12H2,1-2H3,(H,19,20) |
| InChIKey | XMTUKANBWKSLSF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|