C20H22N2O4 — CID 11784622
methyl (3S)-3-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 11784622) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl (3S)-3-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (3S)-3-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 11784622 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl (3S)-3-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C[C@H](N)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H22N2O4/c1-25-19(23)10-13(21)11-22-20(24)26-12-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,13,18H,10-12,21H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | PABPLPPQXBOZBX-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |