C19H17N3O2 — CID 64531827
9H-fluoren-9-ylmethyl N-(1H-imidazol-2-ylmethyl)carbamate (PubChem CID 64531827) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(1H-imidazol-2-ylmethyl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(1H-imidazol-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 64531827 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(1H-imidazol-2-ylmethyl)carbamate |
| SMILES | O=C(NCc1ncc[nH]1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H17N3O2/c23-19(22-11-18-20-9-10-21-18)24-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-10,17H,11-12H2,(H,20,21)(H,22,23) |
| InChIKey | VARCRUBCOYFHEJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |