C42H51N3O4 — CID 59268479
tert-butyl N-[3-[3-[9-ethyl-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]carbazol-3-yl]phenyl]propyl]carbamate (PubChem CID 59268479) has the molecular formula C42H51N3O4 and a molecular weight of 661.89 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[9-ethyl-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]carbazol-3-yl]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[9-ethyl-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]carbazol-3-yl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59268479 |
| Molecular Formula | C42H51N3O4 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.39 |
| IUPAC Name | tert-butyl N-[3-[3-[9-ethyl-6-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]carbazol-3-yl]phenyl]propyl]carbamate |
| SMILES | CCn1c2ccc(-c3cccc(CCCNC(=O)OC(C)(C)C)c3)cc2c2cc(-c3cccc(CCCNC(=O)OC(C)(C)C)c3)ccc21 |
| InChI | InChI=1S/C42H51N3O4/c1-8-45-37-21-19-33(31-17-9-13-29(25-31)15-11-23-43-39(46)48-41(2,3)4)27-35(37)36-28-34(20-22-38(36)45)32-18-10-14-30(26-32)16-12-24-44-40(47)49-42(5,6)7/h9-10,13-14,17-22,25-28H,8,11-12,15-16,23-24H2,1-7H3,(H,43,46)(H,44,47) |
| InChIKey | NDYNNRYDAHBNGO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|