C23H27NO2 — CID 66628868
tert-butyl N-[3-[3-(3-phenylprop-1-ynyl)phenyl]propyl]carbamate (PubChem CID 66628868) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(3-phenylprop-1-ynyl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(3-phenylprop-1-ynyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 66628868 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl N-[3-[3-(3-phenylprop-1-ynyl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cccc(C#CCc2ccccc2)c1 |
| InChI | InChI=1S/C23H27NO2/c1-23(2,3)26-22(25)24-17-9-16-21-15-8-14-20(18-21)13-7-12-19-10-5-4-6-11-19/h4-6,8,10-11,14-15,18H,9,12,16-17H2,1-3H3,(H,24,25) |
| InChIKey | PESZUIITVSBSPC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|