C19H25NO4 — CID 171843917
methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]benzoate (PubChem CID 171843917) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]benzoate.
| Compound Name | methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]benzoate |
|---|---|
| PubChem CID | 171843917 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#CCCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H25NO4/c1-19(2,3)24-18(22)20-13-8-6-5-7-10-15-11-9-12-16(14-15)17(21)23-4/h9,11-12,14H,5-6,8,13H2,1-4H3,(H,20,22) |
| InChIKey | XOPUDAWPXPQHRD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|