C27H24O8 — CID 10719366
dimethyl 5-[7-[3,5-bis(methoxycarbonyl)phenyl]hepta-1,6-diynyl]benzene-1,3-dicarboxylate (PubChem CID 10719366) has the molecular formula C27H24O8 and a molecular weight of 476.48 g/mol. Its IUPAC name is dimethyl 5-[7-[3,5-bis(methoxycarbonyl)phenyl]hepta-1,6-diynyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[7-[3,5-bis(methoxycarbonyl)phenyl]hepta-1,6-diynyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10719366 |
| Molecular Formula | C27H24O8 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | dimethyl 5-[7-[3,5-bis(methoxycarbonyl)phenyl]hepta-1,6-diynyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C#CCCCC#Cc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C27H24O8/c1-32-24(28)20-12-18(13-21(16-20)25(29)33-2)10-8-6-5-7-9-11-19-14-22(26(30)34-3)17-23(15-19)27(31)35-4/h12-17H,5-7H2,1-4H3 |
| InChIKey | LDBXYWPVZUTOMC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|