C21H19ClN2O2 — CID 89494457
methyl 3-[4-(6-chlorohex-1-ynyl)phenyl]benzimidazole-5-carboxylate (PubChem CID 89494457) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is methyl 3-[4-(6-chlorohex-1-ynyl)phenyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 3-[4-(6-chlorohex-1-ynyl)phenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 89494457 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | methyl 3-[4-(6-chlorohex-1-ynyl)phenyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2ncn(-c3ccc(C#CCCCCCl)cc3)c2c1 |
| InChI | InChI=1S/C21H19ClN2O2/c1-26-21(25)17-9-12-19-20(14-17)24(15-23-19)18-10-7-16(8-11-18)6-4-2-3-5-13-22/h7-12,14-15H,2-3,5,13H2,1H3 |
| InChIKey | GEGOXDYGXKTZOW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|