C28H29N5OS2 — CID 71550078
(5Z)-5-[[3-[4-[6-(4-methylpiperazin-1-yl)hex-1-ynyl]phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71550078) has the molecular formula C28H29N5OS2 and a molecular weight of 515.71 g/mol. Its IUPAC name is (5Z)-5-[[3-[4-[6-(4-methylpiperazin-1-yl)hex-1-ynyl]phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[4-[6-(4-methylpiperazin-1-yl)hex-1-ynyl]phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71550078 |
| Molecular Formula | C28H29N5OS2 |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (5Z)-5-[[3-[4-[6-(4-methylpiperazin-1-yl)hex-1-ynyl]phenyl]benzimidazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCN(CCCCC#Cc2ccc(-n3cnc4ccc(/C=C5\SC(=S)NC5=O)cc43)cc2)CC1 |
| InChI | InChI=1S/C28H29N5OS2/c1-31-14-16-32(17-15-31)13-5-3-2-4-6-21-7-10-23(11-8-21)33-20-29-24-12-9-22(18-25(24)33)19-26-27(34)30-28(35)36-26/h7-12,18-20H,2-3,5,13-17H2,1H3,(H,30,34,35)/b26-19- |
| InChIKey | JAFMZBLYBDVKIN-XHPQRKPJSA-N |
| XLogP | 4.28 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|